C46H48N4O4S2 — CID 91162090
S-[5-[4-[15-[4-(5-acetylsulfanylpentoxy)phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]pentyl] ethanethioate (PubChem CID 91162090) has the molecular formula C46H48N4O4S2 and a molecular weight of 785.05 g/mol. Its IUPAC name is S-[5-[4-[15-[4-(5-acetylsulfanylpentoxy)phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]pentyl] ethanethioate.
| Compound Name | S-[5-[4-[15-[4-(5-acetylsulfanylpentoxy)phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]pentyl] ethanethioate |
|---|---|
| PubChem CID | 91162090 |
| Molecular Formula | C46H48N4O4S2 |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.31 |
| IUPAC Name | S-[5-[4-[15-[4-(5-acetylsulfanylpentoxy)phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]pentyl] ethanethioate |
| SMILES | CC(=O)SCCCCCOc1ccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3ccc(OCCCCCSC(C)=O)cc3)=c3ccc([nH]3)=Cc3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C46H48N4O4S2/c1-31(51)55-27-7-3-5-25-53-39-17-9-33(10-18-39)45-41-21-13-35(47-41)29-37-15-23-43(49-37)46(44-24-16-38(50-44)30-36-14-22-42(45)48-36)34-11-19-40(20-12-34)54-26-6-4-8-28-56-32(2)52/h9-24,29-30,47-50H,3-8,25-28H2,1-2H3 |
| InChIKey | ZRBFKMGMLDINEU-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|