C32H28Cl3NO8 — CID 91162912
[2,5-dibenzoyloxy-4-propyl-7-(2,2,2-trichloroethanimidoyl)oxy-6-oxabicyclo[3.2.0]heptan-3-yl] benzoate (PubChem CID 91162912) has the molecular formula C32H28Cl3NO8 and a molecular weight of 660.93 g/mol. Its IUPAC name is [2,5-dibenzoyloxy-4-propyl-7-(2,2,2-trichloroethanimidoyl)oxy-6-oxabicyclo[3.2.0]heptan-3-yl] benzoate.
| Compound Name | [2,5-dibenzoyloxy-4-propyl-7-(2,2,2-trichloroethanimidoyl)oxy-6-oxabicyclo[3.2.0]heptan-3-yl] benzoate |
|---|---|
| PubChem CID | 91162912 |
| Molecular Formula | C32H28Cl3NO8 |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 659.09 |
| IUPAC Name | [2,5-dibenzoyloxy-4-propyl-7-(2,2,2-trichloroethanimidoyl)oxy-6-oxabicyclo[3.2.0]heptan-3-yl] benzoate |
| SMILES | [H]/N=C(/OC1OC2(OC(=O)c3ccccc3)C(CCC)C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C32H28Cl3NO8/c1-2-12-22-24(40-26(37)19-13-6-3-7-14-19)25(41-27(38)20-15-8-4-9-16-20)23-29(42-30(36)32(33,34)35)44-31(22,23)43-28(39)21-17-10-5-11-18-21/h3-11,13-18,22-25,29,36H,2,12H2,1H3/b36-30+ |
| InChIKey | TUASAZHWWNAHNO-FMIFUCRQSA-N |
| XLogP | 6.76 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|