C15H12Cl3NO4 — CID 91163257
6-(chloromethyl)-4-(2,4-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 91163257) has the molecular formula C15H12Cl3NO4 and a molecular weight of 376.62 g/mol. Its IUPAC name is 6-(chloromethyl)-4-(2,4-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 6-(chloromethyl)-4-(2,4-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 91163257 |
| Molecular Formula | C15H12Cl3NO4 |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 6-(chloromethyl)-4-(2,4-dichlorophenyl)-2-methyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(CCl)=C(C(=O)O)C(c2ccc(Cl)cc2Cl)C1C(=O)O |
| InChI | InChI=1S/C15H12Cl3NO4/c1-6-11(14(20)21)12(8-3-2-7(17)4-9(8)18)13(15(22)23)10(5-16)19-6/h2-4,11-12H,5H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | WYXCWNUATJPJDW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|