C11H12O4 — CID 91163520
(4-methoxyphenyl) (2S,3R)-3-methyloxirane-2-carboxylate (PubChem CID 91163520) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (4-methoxyphenyl) (2S,3R)-3-methyloxirane-2-carboxylate.
| Compound Name | (4-methoxyphenyl) (2S,3R)-3-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 91163520 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (4-methoxyphenyl) (2S,3R)-3-methyloxirane-2-carboxylate |
| SMILES | COc1ccc(OC(=O)[C@H]2O[C@@H]2C)cc1 |
| InChI | InChI=1S/C11H12O4/c1-7-10(14-7)11(12)15-9-5-3-8(13-2)4-6-9/h3-7,10H,1-2H3/t7-,10+/m1/s1 |
| InChIKey | JZKKXKXJGKAMPC-XCBNKYQSSA-N |
| XLogP | 1.39 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|