C13H20O5 — CID 91164810
ethane;3-methyl-4-[(4-methyl-2-oxooxolan-3-yl)methyl]oxolane-2,5-dione (PubChem CID 91164810) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethane;3-methyl-4-[(4-methyl-2-oxooxolan-3-yl)methyl]oxolane-2,5-dione.
| Compound Name | ethane;3-methyl-4-[(4-methyl-2-oxooxolan-3-yl)methyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 91164810 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethane;3-methyl-4-[(4-methyl-2-oxooxolan-3-yl)methyl]oxolane-2,5-dione |
| SMILES | CC.CC1COC(=O)C1CC1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C11H14O5.C2H6/c1-5-4-15-10(13)7(5)3-8-6(2)9(12)16-11(8)14;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | IBULYQZOIFTNQO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|