C42H37F3O9S — CID 91165769
ethyl 4-methyl-7-phenylmethoxynaphthalene-2-carboxylate;ethyl 7-phenylmethoxy-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate (PubChem CID 91165769) has the molecular formula C42H37F3O9S and a molecular weight of 774.81 g/mol. Its IUPAC name is ethyl 4-methyl-7-phenylmethoxynaphthalene-2-carboxylate;ethyl 7-phenylmethoxy-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate.
| Compound Name | ethyl 4-methyl-7-phenylmethoxynaphthalene-2-carboxylate;ethyl 7-phenylmethoxy-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 91165769 |
| Molecular Formula | C42H37F3O9S |
| Molecular Weight | 774.81 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | ethyl 4-methyl-7-phenylmethoxynaphthalene-2-carboxylate;ethyl 7-phenylmethoxy-4-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C)c2ccc(OCc3ccccc3)cc2c1.CCOC(=O)c1cc(OS(=O)(=O)C(F)(F)F)c2ccc(OCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C21H17F3O6S.C21H20O3/c1-2-28-20(25)16-10-15-11-17(29-13-14-6-4-3-5-7-14)8-9-18(15)19(12-16)30-31(26,27)21(22,23)24;1-3-23-21(22)18-11-15(2)20-10-9-19(13-17(20)12-18)24-14-16-7-5-4-6-8-16/h3-12H,2,13H2,1H3;4-13H,3,14H2,1-2H3 |
| InChIKey | MJJOIMLONWXKRD-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.81 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|