C11H17- — CID 91167200
3,3,4,5-tetramethylhept-4-en-1-yne (PubChem CID 91167200) has the molecular formula C11H17- and a molecular weight of 149.26 g/mol. Its IUPAC name is 3,3,4,5-tetramethylhept-4-en-1-yne.
| Compound Name | 3,3,4,5-tetramethylhept-4-en-1-yne |
|---|---|
| PubChem CID | 91167200 |
| Molecular Formula | C11H17- |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.13 |
| IUPAC Name | 3,3,4,5-tetramethylhept-4-en-1-yne |
| SMILES | C#CC(C)(C)C(C)=C(C)[CH-]C |
| InChI | InChI=1S/C11H17/c1-7-9(3)10(4)11(5,6)8-2/h2,7H,1,3-6H3/q-1 |
| InChIKey | ZHJMVMQECDARFC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|