C20H20N2O3 — CID 91171384
benzyl N-[(2R,3R,4R)-4-(cyanomethyl)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 91171384) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is benzyl N-[(2R,3R,4R)-4-(cyanomethyl)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R,4R)-4-(cyanomethyl)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 91171384 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | benzyl N-[(2R,3R,4R)-4-(cyanomethyl)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | N#CC[C@@H]1c2ccccc2C[C@@H](NC(=O)OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C20H20N2O3/c21-11-10-17-16-9-5-4-8-15(16)12-18(19(17)23)22-20(24)25-13-14-6-2-1-3-7-14/h1-9,17-19,23H,10,12-13H2,(H,22,24)/t17-,18-,19-/m1/s1 |
| InChIKey | KAHWABMFDTXRDT-GUDVDZBRSA-N |
| XLogP | 2.90 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |