C23H17ClN4O2 — CID 91175450
N-[4-(chloro-cyano-phenylmethyl)phenyl]-3-pyridin-3-yl-2,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 91175450) has the molecular formula C23H17ClN4O2 and a molecular weight of 416.87 g/mol. Its IUPAC name is N-[4-(chloro-cyano-phenylmethyl)phenyl]-3-pyridin-3-yl-2,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(chloro-cyano-phenylmethyl)phenyl]-3-pyridin-3-yl-2,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91175450 |
| Molecular Formula | C23H17ClN4O2 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(chloro-cyano-phenylmethyl)phenyl]-3-pyridin-3-yl-2,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | N#CC(Cl)(c1ccccc1)c1ccc(NC(=O)C2C=C(c3cccnc3)NO2)cc1 |
| InChI | InChI=1S/C23H17ClN4O2/c24-23(15-25,17-6-2-1-3-7-17)18-8-10-19(11-9-18)27-22(29)21-13-20(28-30-21)16-5-4-12-26-14-16/h1-14,21,28H,(H,27,29) |
| InChIKey | HQXPUKKWJYJMQX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|