C16H22N2O4 — CID 91179644
tert-butyl N-[1-(1,3-benzoxazol-2-yl)-1-hydroxybutyl]carbamate (PubChem CID 91179644) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-benzoxazol-2-yl)-1-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[1-(1,3-benzoxazol-2-yl)-1-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 91179644 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl N-[1-(1,3-benzoxazol-2-yl)-1-hydroxybutyl]carbamate |
| SMILES | CCCC(O)(NC(=O)OC(C)(C)C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H22N2O4/c1-5-10-16(20,18-14(19)22-15(2,3)4)13-17-11-8-6-7-9-12(11)21-13/h6-9,20H,5,10H2,1-4H3,(H,18,19) |
| InChIKey | FZDFZYXYTUMHBP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|