C19H26N4O4S2 — CID 91180235
[5-[[4-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methylamino]-5-oxopent-1-en-3-yl] 2-formamido-3-methylbutanoate (PubChem CID 91180235) has the molecular formula C19H26N4O4S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is [5-[[4-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methylamino]-5-oxopent-1-en-3-yl] 2-formamido-3-methylbutanoate.
| Compound Name | [5-[[4-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methylamino]-5-oxopent-1-en-3-yl] 2-formamido-3-methylbutanoate |
|---|---|
| PubChem CID | 91180235 |
| Molecular Formula | C19H26N4O4S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [5-[[4-(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)-1,3-thiazol-2-yl]methylamino]-5-oxopent-1-en-3-yl] 2-formamido-3-methylbutanoate |
| SMILES | C=CC(CC(=O)NCc1nc(C2=NC(C)CS2)cs1)OC(=O)C(NC=O)C(C)C |
| InChI | InChI=1S/C19H26N4O4S2/c1-5-13(27-19(26)17(11(2)3)21-10-24)6-15(25)20-7-16-23-14(9-28-16)18-22-12(4)8-29-18/h5,9-13,17H,1,6-8H2,2-4H3,(H,20,25)(H,21,24) |
| InChIKey | CFHZQTIBPJCVJE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|