C12H13NO4S — CID 91180433
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-ethoxymethanethione (PubChem CID 91180433) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-ethoxymethanethione.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-ethoxymethanethione |
|---|---|
| PubChem CID | 91180433 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-ethoxymethanethione |
| SMILES | CCOC(=S)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C12H13NO4S/c1-2-16-12(18)17-13-10(14)8-6-3-4-7(5-6)9(8)11(13)15/h3-4,6-7,14-15H,2,5H2,1H3 |
| InChIKey | WFSYPGJMQMUOTH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|