C29H37ClFN9O2 — CID 91183417
2-chloro-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol (PubChem CID 91183417) has the molecular formula C29H37ClFN9O2 and a molecular weight of 598.13 g/mol. Its IUPAC name is 2-chloro-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol.
| Compound Name | 2-chloro-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
|---|---|
| PubChem CID | 91183417 |
| Molecular Formula | C29H37ClFN9O2 |
| Molecular Weight | 598.13 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 2-chloro-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
| SMILES | CN1CCN(Cc2ccc(Nc3cc(Cl)c(O)c(C/N=N/c4ncc(F)c(N5CCN(CCO)CC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C29H37ClFN9O2/c1-37-6-8-39(9-7-37)20-21-2-4-23(5-3-21)34-24-16-22(27(42)25(30)17-24)18-33-36-29-32-19-26(31)28(35-29)40-12-10-38(11-13-40)14-15-41/h2-5,16-17,19,34,41-42H,6-15,18,20H2,1H3/b36-33+ |
| InChIKey | UVQXCSRFQOCEGA-PKUSAGTQSA-N |
| XLogP | 3.86 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.13 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|