C11H23NOP+ — CID 91186189
2,2-dimethyl-3-[4-methylpentan-2-yl(phosphanyl)amino]propanal (PubChem CID 91186189) has the molecular formula C11H23NOP+ and a molecular weight of 216.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-methylpentan-2-yl(phosphanyl)amino]propanal.
| Compound Name | 2,2-dimethyl-3-[4-methylpentan-2-yl(phosphanyl)amino]propanal |
|---|---|
| PubChem CID | 91186189 |
| Molecular Formula | C11H23NOP+ |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,2-dimethyl-3-[4-methylpentan-2-yl(phosphanyl)amino]propanal |
| SMILES | [CH2+]C(C)CC(C)N(P)CC(C)(C)C=O |
| InChI | InChI=1S/C11H23NOP/c1-9(2)6-10(3)12(14)7-11(4,5)8-13/h8-10H,1,6-7,14H2,2-5H3/q+1 |
| InChIKey | VAZYCGNPKVPGFH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|