C14H17N3O2S — CID 911934
ethyl 3-cyano-6-ethyl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-4-carboxylate (PubChem CID 911934) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is ethyl 3-cyano-6-ethyl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-4-carboxylate.
| Compound Name | ethyl 3-cyano-6-ethyl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-4-carboxylate |
|---|---|
| PubChem CID | 911934 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 3-cyano-6-ethyl-2-sulfanylidene-1,5,7,8-tetrahydro-1,6-naphthyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c2c([nH]c(=S)c1C#N)CCN(CC)C2 |
| InChI | InChI=1S/C14H17N3O2S/c1-3-17-6-5-11-10(8-17)12(14(18)19-4-2)9(7-15)13(20)16-11/h3-6,8H2,1-2H3,(H,16,20) |
| InChIKey | YXKRHWXRQWOGIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|