C10H16O5S — CID 91193521
(1R)-1-[(5'R,6'S)-spiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]-6'-yl]ethanesulfonic acid (PubChem CID 91193521) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is (1R)-1-[(5'R,6'S)-spiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]-6'-yl]ethanesulfonic acid.
| Compound Name | (1R)-1-[(5'R,6'S)-spiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]-6'-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 91193521 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1R)-1-[(5'R,6'S)-spiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]-6'-yl]ethanesulfonic acid |
| SMILES | C[C@H]([C@@H]1C2[C@H]1CCC21OCCO1)S(=O)(=O)O |
| InChI | InChI=1S/C10H16O5S/c1-6(16(11,12)13)8-7-2-3-10(9(7)8)14-4-5-15-10/h6-9H,2-5H2,1H3,(H,11,12,13)/t6-,7+,8+,9?/m1/s1 |
| InChIKey | TWDROKOKANDKGY-ROVKLQMOSA-N |
| XLogP | 0.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|