C32H44N2O7 — CID 91196136
tert-butyl 2-[[4-[[15-(aminomethyl)-8-methoxy-3-methyl-10-oxapentacyclo[7.7.1.01,11.02,15.05,17]heptadeca-5(17),6,8,13-tetraen-12-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoate (PubChem CID 91196136) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is tert-butyl 2-[[4-[[15-(aminomethyl)-8-methoxy-3-methyl-10-oxapentacyclo[7.7.1.01,11.02,15.05,17]heptadeca-5(17),6,8,13-tetraen-12-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl 2-[[4-[[15-(aminomethyl)-8-methoxy-3-methyl-10-oxapentacyclo[7.7.1.01,11.02,15.05,17]heptadeca-5(17),6,8,13-tetraen-12-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91196136 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | tert-butyl 2-[[4-[[15-(aminomethyl)-8-methoxy-3-methyl-10-oxapentacyclo[7.7.1.01,11.02,15.05,17]heptadeca-5(17),6,8,13-tetraen-12-yl]oxy]-4-oxobutanoyl]amino]-3-methylbutanoate |
| SMILES | COc1ccc2c3c1OC1C(OC(=O)CCC(=O)NC(C(=O)OC(C)(C)C)C(C)C)C=CC4(CN)CC31C4C(C)C2 |
| InChI | InChI=1S/C32H44N2O7/c1-17(2)25(29(37)41-30(4,5)6)34-22(35)10-11-23(36)39-21-12-13-31(16-33)15-32-24-19(14-18(3)27(31)32)8-9-20(38-7)26(24)40-28(21)32/h8-9,12-13,17-18,21,25,27-28H,10-11,14-16,33H2,1-7H3,(H,34,35) |
| InChIKey | CNAKDWLHESFIGE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|