C20H18N2O4S — CID 91196268
(2,5-dihydroxypyrrol-1-yl) 4-phenothiazin-10-ylbutanoate (PubChem CID 91196268) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-phenothiazin-10-ylbutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-phenothiazin-10-ylbutanoate |
|---|---|
| PubChem CID | 91196268 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-phenothiazin-10-ylbutanoate |
| SMILES | O=C(CCCN1c2ccccc2Sc2ccccc21)On1c(O)ccc1O |
| InChI | InChI=1S/C20H18N2O4S/c23-18-11-12-19(24)22(18)26-20(25)10-5-13-21-14-6-1-3-8-16(14)27-17-9-4-2-7-15(17)21/h1-4,6-9,11-12,23-24H,5,10,13H2 |
| InChIKey | DMWLXJHTCAJPLU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|