About 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene
3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene (PubChem CID 91197631) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene.
Analyze 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The IUPAC name of 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene (CID 91197631) is 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene.
What is the SMILES notation for 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The canonical SMILES for 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene is CC1=Cc2ccc(C)cc21.
What is the InChIKey of 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
The InChIKey is KGDSZFWURIWQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-7-3-4-9-6-8(2)10(9)5-7/h3-6H,1-2H3.
What are the key properties of 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene?
3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene has a molecular weight of 130.19 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethylbicyclo[4.2.0]octa-1(6),2,4,7-tetraene is sourced from PubChem (CID 91197631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).