C18H13FN4OS — CID 91199595
N-[6-(4-aminophenyl)-7-fluoro-1H-indazol-3-yl]thiophene-2-carboxamide (PubChem CID 91199595) has the molecular formula C18H13FN4OS and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[6-(4-aminophenyl)-7-fluoro-1H-indazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-(4-aminophenyl)-7-fluoro-1H-indazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91199595 |
| Molecular Formula | C18H13FN4OS |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[6-(4-aminophenyl)-7-fluoro-1H-indazol-3-yl]thiophene-2-carboxamide |
| SMILES | Nc1ccc(-c2ccc3c(NC(=O)c4cccs4)n[nH]c3c2F)cc1 |
| InChI | InChI=1S/C18H13FN4OS/c19-15-12(10-3-5-11(20)6-4-10)7-8-13-16(15)22-23-17(13)21-18(24)14-2-1-9-25-14/h1-9H,20H2,(H2,21,22,23,24) |
| InChIKey | QXAGDKBEFJFWPF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|