C13H8F3N3OS — CID 91808065
N-[7-(trifluoromethyl)-1H-indazol-3-yl]thiophene-2-carboxamide (PubChem CID 91808065) has the molecular formula C13H8F3N3OS and a molecular weight of 311.29 g/mol. Its IUPAC name is N-[7-(trifluoromethyl)-1H-indazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[7-(trifluoromethyl)-1H-indazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91808065 |
| Molecular Formula | C13H8F3N3OS |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-[7-(trifluoromethyl)-1H-indazol-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1n[nH]c2c(C(F)(F)F)cccc12)c1cccs1 |
| InChI | InChI=1S/C13H8F3N3OS/c14-13(15,16)8-4-1-3-7-10(8)18-19-11(7)17-12(20)9-5-2-6-21-9/h1-6H,(H2,17,18,19,20) |
| InChIKey | MJZYGRRNSQNONW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |