C25H30N4O5 — CID 91199768
6-[2-hydroxy-2-[4-[[5-(1-hydroxy-2-phenoxyethyl)pyrrolidin-2-yl]methyl]anilino]ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 91199768) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-[2-hydroxy-2-[4-[[5-(1-hydroxy-2-phenoxyethyl)pyrrolidin-2-yl]methyl]anilino]ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-hydroxy-2-[4-[[5-(1-hydroxy-2-phenoxyethyl)pyrrolidin-2-yl]methyl]anilino]ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91199768 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-[2-hydroxy-2-[4-[[5-(1-hydroxy-2-phenoxyethyl)pyrrolidin-2-yl]methyl]anilino]ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CC(O)Nc2ccc(CC3CCC(C(O)COc4ccccc4)N3)cc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C25H30N4O5/c30-22(15-34-20-4-2-1-3-5-20)21-11-10-18(26-21)12-16-6-8-17(9-7-16)27-23(31)13-19-14-24(32)29-25(33)28-19/h1-9,14,18,21-23,26-27,30-31H,10-13,15H2,(H2,28,29,32,33) |
| InChIKey | KKVPOFFQSSTODJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|