C28H30F6N4O7S — CID 87146739
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[[(2S,5R)-5-[(1S)-1-hydroxy-2-phenoxyethyl]pyrrolidin-2-yl]methyl]phenyl]acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87146739) has the molecular formula C28H30F6N4O7S and a molecular weight of 680.62 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[[(2S,5R)-5-[(1S)-1-hydroxy-2-phenoxyethyl]pyrrolidin-2-yl]methyl]phenyl]acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[[(2S,5R)-5-[(1S)-1-hydroxy-2-phenoxyethyl]pyrrolidin-2-yl]methyl]phenyl]acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87146739 |
| Molecular Formula | C28H30F6N4O7S |
| Molecular Weight | 680.62 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[[(2S,5R)-5-[(1S)-1-hydroxy-2-phenoxyethyl]pyrrolidin-2-yl]methyl]phenyl]acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1nc(CC(=O)Nc2ccc(C[C@@H]3CC[C@H]([C@H](O)COc4ccccc4)N3)cc2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28N4O3S.2C2HF3O2/c25-24-28-19(15-32-24)13-23(30)27-17-8-6-16(7-9-17)12-18-10-11-21(26-18)22(29)14-31-20-4-2-1-3-5-20;2*3-2(4,5)1(6)7/h1-9,15,18,21-22,26,29H,10-14H2,(H2,25,28)(H,27,30);2*(H,6,7)/t18-,21+,22+;;/m0../s1 |
| InChIKey | LTEOLAWMRVIVFK-ZWOTYEBKSA-N |
| XLogP | 4.28 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |