C12H19NO7S — CID 91210028
3-(2,5-dihydroxypyrrol-1-yl)oxysulfonylpropyl 2-methylbutanoate (PubChem CID 91210028) has the molecular formula C12H19NO7S and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)oxysulfonylpropyl 2-methylbutanoate.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)oxysulfonylpropyl 2-methylbutanoate |
|---|---|
| PubChem CID | 91210028 |
| Molecular Formula | C12H19NO7S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)oxysulfonylpropyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCS(=O)(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H19NO7S/c1-3-9(2)12(16)19-7-4-8-21(17,18)20-13-10(14)5-6-11(13)15/h5-6,9,14-15H,3-4,7-8H2,1-2H3 |
| InChIKey | IJQAFVUQRBTQLD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|