C17H10F15NO — CID 91214153
5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 91214153) has the molecular formula C17H10F15NO and a molecular weight of 529.24 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91214153 |
| Molecular Formula | C17H10F15NO |
| Molecular Weight | 529.24 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 5-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C17H10F15NO/c18-11(19,7-9-6-10(33-34-9)8-4-2-1-3-5-8)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h1-6,9,33H,7H2 |
| InChIKey | FZPIRKAPBBRROH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.24 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|