C12H15NO2 — CID 91214374
2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanamine (PubChem CID 91214374) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanamine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanamine |
|---|---|
| PubChem CID | 91214374 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanamine |
| SMILES | NC(CC1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C12H15NO2/c13-11(12-9-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-2,4,6-7,9,11H,3,5,8,13H2 |
| InChIKey | LFUSHMMHNAKOGA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |