C11H13NO4S — CID 57479929
2-[cyclohexa-1,3-dien-1-yl-(sulfinoamino)methyl]-1,4-dioxine (PubChem CID 57479929) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-[cyclohexa-1,3-dien-1-yl-(sulfinoamino)methyl]-1,4-dioxine.
| Compound Name | 2-[cyclohexa-1,3-dien-1-yl-(sulfinoamino)methyl]-1,4-dioxine |
|---|---|
| PubChem CID | 57479929 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-[cyclohexa-1,3-dien-1-yl-(sulfinoamino)methyl]-1,4-dioxine |
| SMILES | O=S(O)NC(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C11H13NO4S/c13-17(14)12-11(9-4-2-1-3-5-9)10-8-15-6-7-16-10/h1-2,4,6-8,11-12H,3,5H2,(H,13,14) |
| InChIKey | AODQYPSQWAVINN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|