C11H12ClNO4S — CID 57464653
2-[(2-chlorocyclohexa-1,3-dien-1-yl)-(sulfinoamino)methyl]-1,4-dioxine (PubChem CID 57464653) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-[(2-chlorocyclohexa-1,3-dien-1-yl)-(sulfinoamino)methyl]-1,4-dioxine.
| Compound Name | 2-[(2-chlorocyclohexa-1,3-dien-1-yl)-(sulfinoamino)methyl]-1,4-dioxine |
|---|---|
| PubChem CID | 57464653 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[(2-chlorocyclohexa-1,3-dien-1-yl)-(sulfinoamino)methyl]-1,4-dioxine |
| SMILES | O=S(O)NC(C1=COC=CO1)C1=C(Cl)C=CCC1 |
| InChI | InChI=1S/C11H12ClNO4S/c12-9-4-2-1-3-8(9)11(13-18(14)15)10-7-16-5-6-17-10/h2,4-7,11,13H,1,3H2,(H,14,15) |
| InChIKey | ZHFFYVMUYACJHD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|