C12H15NO4S — CID 66687056
2-[cyclohexa-1,3-dien-1-yl-[methyl(sulfino)amino]methyl]-1,4-dioxine (PubChem CID 66687056) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[cyclohexa-1,3-dien-1-yl-[methyl(sulfino)amino]methyl]-1,4-dioxine.
| Compound Name | 2-[cyclohexa-1,3-dien-1-yl-[methyl(sulfino)amino]methyl]-1,4-dioxine |
|---|---|
| PubChem CID | 66687056 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[cyclohexa-1,3-dien-1-yl-[methyl(sulfino)amino]methyl]-1,4-dioxine |
| SMILES | CN(C(C1=CC=CCC1)C1=COC=CO1)S(=O)O |
| InChI | InChI=1S/C12H15NO4S/c1-13(18(14)15)12(10-5-3-2-4-6-10)11-9-16-7-8-17-11/h2-3,5,7-9,12H,4,6H2,1H3,(H,14,15) |
| InChIKey | LSRCFQIDNZNBKG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|