C24H30BrNO2 — CID 91216250
1-benzyl-4-[(1R,3S)-1-(bromomethyl)-5-methoxy-6-methyl-3,4-dihydro-1H-isochromen-3-yl]piperidine (PubChem CID 91216250) has the molecular formula C24H30BrNO2 and a molecular weight of 444.41 g/mol. Its IUPAC name is 1-benzyl-4-[(1R,3S)-1-(bromomethyl)-5-methoxy-6-methyl-3,4-dihydro-1H-isochromen-3-yl]piperidine.
| Compound Name | 1-benzyl-4-[(1R,3S)-1-(bromomethyl)-5-methoxy-6-methyl-3,4-dihydro-1H-isochromen-3-yl]piperidine |
|---|---|
| PubChem CID | 91216250 |
| Molecular Formula | C24H30BrNO2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 1-benzyl-4-[(1R,3S)-1-(bromomethyl)-5-methoxy-6-methyl-3,4-dihydro-1H-isochromen-3-yl]piperidine |
| SMILES | COc1c(C)ccc2c1C[C@@H](C1CCN(Cc3ccccc3)CC1)O[C@H]2CBr |
| InChI | InChI=1S/C24H30BrNO2/c1-17-8-9-20-21(24(17)27-2)14-22(28-23(20)15-25)19-10-12-26(13-11-19)16-18-6-4-3-5-7-18/h3-9,19,22-23H,10-16H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | WMPHRIOTAXWHAN-GOTSBHOMSA-N |
| XLogP | 5.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|