C14H25N3S — CID 9122148
1-(cyclohexylideneamino)-3-[(1S,2S)-2-methylcyclohexyl]thiourea (PubChem CID 9122148) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-(cyclohexylideneamino)-3-[(1S,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(cyclohexylideneamino)-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9122148 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(cyclohexylideneamino)-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)NN=C1CCCCC1 |
| InChI | InChI=1S/C14H25N3S/c1-11-7-5-6-10-13(11)15-14(18)17-16-12-8-3-2-4-9-12/h11,13H,2-10H2,1H3,(H2,15,17,18)/t11-,13-/m0/s1 |
| InChIKey | QSPKNJSDVSFFRH-AAEUAGOBSA-N |
| XLogP | 3.35 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|