C15H27N3S — CID 9122110
1-(cycloheptylideneamino)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 9122110) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 1-(cycloheptylideneamino)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(cycloheptylideneamino)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9122110 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-(cycloheptylideneamino)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)NN=C1CCCCCC1 |
| InChI | InChI=1S/C15H27N3S/c1-12-8-6-7-11-14(12)16-15(19)18-17-13-9-4-2-3-5-10-13/h12,14H,2-11H2,1H3,(H2,16,18,19)/t12-,14+/m0/s1 |
| InChIKey | ULTPJUZAYMUCRJ-GXTWGEPZSA-N |
| XLogP | 3.74 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|