C13H23N3S — CID 9122119
1-(cyclopentylideneamino)-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 9122119) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(cyclopentylideneamino)-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(cyclopentylideneamino)-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9122119 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-(cyclopentylideneamino)-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NN=C1CCCC1 |
| InChI | InChI=1S/C13H23N3S/c1-10-6-2-5-9-12(10)14-13(17)16-15-11-7-3-4-8-11/h10,12H,2-9H2,1H3,(H2,14,16,17)/t10-,12+/m1/s1 |
| InChIKey | YMVYCWYGAHVIHJ-PWSUYJOCSA-N |
| XLogP | 2.96 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|