C8H11ClN3O2+ — CID 91221918
(2-amino-4,6-dimethylpyrimidin-1-ium-1-yl) 2-chloroacetate (PubChem CID 91221918) has the molecular formula C8H11ClN3O2+ and a molecular weight of 216.65 g/mol. Its IUPAC name is (2-amino-4,6-dimethylpyrimidin-1-ium-1-yl) 2-chloroacetate.
| Compound Name | (2-amino-4,6-dimethylpyrimidin-1-ium-1-yl) 2-chloroacetate |
|---|---|
| PubChem CID | 91221918 |
| Molecular Formula | C8H11ClN3O2+ |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (2-amino-4,6-dimethylpyrimidin-1-ium-1-yl) 2-chloroacetate |
| SMILES | Cc1cc(C)[n+](OC(=O)CCl)c(N)n1 |
| InChI | InChI=1S/C8H10ClN3O2/c1-5-3-6(2)12(8(10)11-5)14-7(13)4-9/h3,10H,4H2,1-2H3/p+1 |
| InChIKey | WPQHEWOOJHLPHW-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|