C6H11N4+ — CID 22220794
4,6-dimethylpyrimidin-1-ium-1,2-diamine (PubChem CID 22220794) has the molecular formula C6H11N4+ and a molecular weight of 139.18 g/mol. Its IUPAC name is 4,6-dimethylpyrimidin-1-ium-1,2-diamine.
| Compound Name | 4,6-dimethylpyrimidin-1-ium-1,2-diamine |
|---|---|
| PubChem CID | 22220794 |
| Molecular Formula | C6H11N4+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4,6-dimethylpyrimidin-1-ium-1,2-diamine |
| SMILES | Cc1cc(C)[n+](N)c(N)n1 |
| InChI | InChI=1S/C6H10N4/c1-4-3-5(2)10(8)6(7)9-4/h3,7H,8H2,1-2H3/p+1 |
| InChIKey | DFEJKANZSXPIPE-UHFFFAOYSA-O |
| XLogP | -0.72 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|