C5H9N4+ — CID 22220834
4-methylpyrimidin-1-ium-1,2-diamine (PubChem CID 22220834) has the molecular formula C5H9N4+ and a molecular weight of 125.15 g/mol. Its IUPAC name is 4-methylpyrimidin-1-ium-1,2-diamine.
| Compound Name | 4-methylpyrimidin-1-ium-1,2-diamine |
|---|---|
| PubChem CID | 22220834 |
| Molecular Formula | C5H9N4+ |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 4-methylpyrimidin-1-ium-1,2-diamine |
| SMILES | Cc1cc[n+](N)c(N)n1 |
| InChI | InChI=1S/C5H8N4/c1-4-2-3-9(7)5(6)8-4/h2-3,6H,7H2,1H3/p+1 |
| InChIKey | SIICUNPDUFKJBI-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|