C7H10N2SY — CID 59922663
1,4,6-trimethylpyrimidin-1-ium-2-thiolate;yttrium (PubChem CID 59922663) has the molecular formula C7H10N2SY and a molecular weight of 243.14 g/mol. Its IUPAC name is 1,4,6-trimethylpyrimidin-1-ium-2-thiolate;yttrium.
| Compound Name | 1,4,6-trimethylpyrimidin-1-ium-2-thiolate;yttrium |
|---|---|
| PubChem CID | 59922663 |
| Molecular Formula | C7H10N2SY |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | 1,4,6-trimethylpyrimidin-1-ium-2-thiolate;yttrium |
| SMILES | Cc1cc(C)[n+](C)c([S-])n1.[Y] |
| InChI | InChI=1S/C7H10N2S.Y/c1-5-4-6(2)9(3)7(10)8-5;/h4H,1-3H3; |
| InChIKey | BGRYEHWUHRFTNN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|