C11H12ClN — CID 44890141
2,3-dimethylisoquinolin-2-ium chloride (PubChem CID 44890141) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 2,3-dimethylisoquinolin-2-ium chloride.
| Compound Name | 2,3-dimethylisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 44890141 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2,3-dimethylisoquinolin-2-ium chloride |
| SMILES | Cc1cc2ccccc2c[n+]1C.[Cl-] |
| InChI | InChI=1S/C11H12N.ClH/c1-9-7-10-5-3-4-6-11(10)8-12(9)2;/h3-8H,1-2H3;1H/q+1;/p-1 |
| InChIKey | AXEPWBVTWIZWHC-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|