C24H24N2+2 — CID 161012906
2-[2,5-dimethyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-3-methylisoquinolin-2-ium (PubChem CID 161012906) has the molecular formula C24H24N2+2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-3-methylisoquinolin-2-ium.
| Compound Name | 2-[2,5-dimethyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-3-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 161012906 |
| Molecular Formula | C24H24N2+2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[2,5-dimethyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-3-methylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2cccc[n+]2C)c(C)c(-[n+]2cc3ccccc3cc2C)c1 |
| InChI | InChI=1S/C24H24N2/c1-17-13-22(23-11-7-8-12-25(23)4)19(3)24(14-17)26-16-21-10-6-5-9-20(21)15-18(26)2/h5-16H,1-4H3/q+2 |
| InChIKey | IRDCWXGHJSNVJI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|