C29H28N2+2 — CID 159382253
2-[2,5-dimethyl-3-(3-methylisoquinolin-2-ium-2-yl)phenyl]-1,3-dimethylquinolin-1-ium (PubChem CID 159382253) has the molecular formula C29H28N2+2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(3-methylisoquinolin-2-ium-2-yl)phenyl]-1,3-dimethylquinolin-1-ium.
| Compound Name | 2-[2,5-dimethyl-3-(3-methylisoquinolin-2-ium-2-yl)phenyl]-1,3-dimethylquinolin-1-ium |
|---|---|
| PubChem CID | 159382253 |
| Molecular Formula | C29H28N2+2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[2,5-dimethyl-3-(3-methylisoquinolin-2-ium-2-yl)phenyl]-1,3-dimethylquinolin-1-ium |
| SMILES | Cc1cc(-c2c(C)cc3ccccc3[n+]2C)c(C)c(-[n+]2cc3ccccc3cc2C)c1 |
| InChI | InChI=1S/C29H28N2/c1-19-14-26(29-20(2)16-24-11-8-9-13-27(24)30(29)5)22(4)28(15-19)31-18-25-12-7-6-10-23(25)17-21(31)3/h6-18H,1-5H3/q+2 |
| InChIKey | LQVBEMXDAMYBHA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|