C29H31N3+2 — CID 161259708
2-[2,5-dimethyl-3-(2-methyl-1-propan-2-ylindazol-2-ium-3-yl)phenyl]-3-methylisoquinolin-2-ium (PubChem CID 161259708) has the molecular formula C29H31N3+2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(2-methyl-1-propan-2-ylindazol-2-ium-3-yl)phenyl]-3-methylisoquinolin-2-ium.
| Compound Name | 2-[2,5-dimethyl-3-(2-methyl-1-propan-2-ylindazol-2-ium-3-yl)phenyl]-3-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 161259708 |
| Molecular Formula | C29H31N3+2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-[2,5-dimethyl-3-(2-methyl-1-propan-2-ylindazol-2-ium-3-yl)phenyl]-3-methylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2c3ccccc3n(C(C)C)[n+]2C)c(C)c(-[n+]2cc3ccccc3cc2C)c1 |
| InChI | InChI=1S/C29H31N3/c1-19(2)32-27-14-10-9-13-25(27)29(30(32)6)26-15-20(3)16-28(22(26)5)31-18-24-12-8-7-11-23(24)17-21(31)4/h7-19H,1-6H3/q+2 |
| InChIKey | OVWWBYAOCWWRCN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|