C28H34N+ — CID 153452485
5-methyl-6-(2,3,5-trimethylphenyl)spiro[9,10-dihydro-7H-phenanthridin-5-ium-8,1'-cyclohexane] (PubChem CID 153452485) has the molecular formula C28H34N+ and a molecular weight of 384.59 g/mol. Its IUPAC name is 5-methyl-6-(2,3,5-trimethylphenyl)spiro[9,10-dihydro-7H-phenanthridin-5-ium-8,1'-cyclohexane].
| Compound Name | 5-methyl-6-(2,3,5-trimethylphenyl)spiro[9,10-dihydro-7H-phenanthridin-5-ium-8,1'-cyclohexane] |
|---|---|
| PubChem CID | 153452485 |
| Molecular Formula | C28H34N+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 5-methyl-6-(2,3,5-trimethylphenyl)spiro[9,10-dihydro-7H-phenanthridin-5-ium-8,1'-cyclohexane] |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(c4ccccc4[n+]2C)CCC2(CCCCC2)C3)c1 |
| InChI | InChI=1S/C28H34N/c1-19-16-20(2)21(3)24(17-19)27-25-18-28(13-8-5-9-14-28)15-12-22(25)23-10-6-7-11-26(23)29(27)4/h6-7,10-11,16-17H,5,8-9,12-15,18H2,1-4H3/q+1 |
| InChIKey | KMBTUKYLBHMGMQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|