C8H11N4+ — CID 20578609
2,5,7-trimethyl-2H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium (PubChem CID 20578609) has the molecular formula C8H11N4+ and a molecular weight of 163.20 g/mol. Its IUPAC name is 2,5,7-trimethyl-2H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium.
| Compound Name | 2,5,7-trimethyl-2H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium |
|---|---|
| PubChem CID | 20578609 |
| Molecular Formula | C8H11N4+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2,5,7-trimethyl-2H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium |
| SMILES | Cc1cc(C)[n+]2c(n1)=NC(C)N=2 |
| InChI | InChI=1S/C8H11N4/c1-5-4-6(2)12-8(9-5)10-7(3)11-12/h4,7H,1-3H3/q+1 |
| InChIKey | VARUBABWEJWXTH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 43.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|