C7H9N3S2 — CID 177483341
2,4-dimethyl-7-thia-5-aza-1-azonia-9-azanidabicyclo[4.3.0]nona-1,3,5-triene-8-thiol (PubChem CID 177483341) has the molecular formula C7H9N3S2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2,4-dimethyl-7-thia-5-aza-1-azonia-9-azanidabicyclo[4.3.0]nona-1,3,5-triene-8-thiol.
| Compound Name | 2,4-dimethyl-7-thia-5-aza-1-azonia-9-azanidabicyclo[4.3.0]nona-1,3,5-triene-8-thiol |
|---|---|
| PubChem CID | 177483341 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2,4-dimethyl-7-thia-5-aza-1-azonia-9-azanidabicyclo[4.3.0]nona-1,3,5-triene-8-thiol |
| SMILES | Cc1cc(C)[n+]2c(n1)SC(S)[N-]2 |
| InChI | InChI=1S/C7H9N3S2/c1-4-3-5(2)10-6(8-4)12-7(11)9-10/h3,7,11H,1-2H3 |
| InChIKey | SFXDMQQPQIGFFO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|