C9H12ClN2O4S+ — CID 126959837
perchloric acid;2,5,7-trimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium (PubChem CID 126959837) has the molecular formula C9H12ClN2O4S+ and a molecular weight of 279.73 g/mol. Its IUPAC name is perchloric acid;2,5,7-trimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium.
| Compound Name | perchloric acid;2,5,7-trimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 126959837 |
| Molecular Formula | C9H12ClN2O4S+ |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | perchloric acid;2,5,7-trimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
| SMILES | Cc1cc(C)[n+]2cc(C)sc2n1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C9H11N2S.ClHO4/c1-6-4-7(2)11-5-8(3)12-9(11)10-6;2-1(3,4)5/h4-5H,1-3H3;(H,2,3,4,5)/q+1; |
| InChIKey | UPSLEVUZDCDPPR-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|