C15H15N2S+ — CID 5171195
5,7-dimethyl-3-(4-methylphenyl)-[1,3]thiazolo[3,2-a]pyrimidin-4-ium (PubChem CID 5171195) has the molecular formula C15H15N2S+ and a molecular weight of 255.37 g/mol. Its IUPAC name is 5,7-dimethyl-3-(4-methylphenyl)-[1,3]thiazolo[3,2-a]pyrimidin-4-ium.
| Compound Name | 5,7-dimethyl-3-(4-methylphenyl)-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 5171195 |
| Molecular Formula | C15H15N2S+ |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5,7-dimethyl-3-(4-methylphenyl)-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
| SMILES | Cc1ccc(-c2csc3nc(C)cc(C)[n+]23)cc1 |
| InChI | InChI=1S/C15H15N2S/c1-10-4-6-13(7-5-10)14-9-18-15-16-11(2)8-12(3)17(14)15/h4-9H,1-3H3/q+1 |
| InChIKey | ZEMHNIDZJGMEPE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|