C14H12ClIN2S — CID 21205363
3-(4-chlorophenyl)-5,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium iodide (PubChem CID 21205363) has the molecular formula C14H12ClIN2S and a molecular weight of 402.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium iodide.
| Compound Name | 3-(4-chlorophenyl)-5,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium iodide |
|---|---|
| PubChem CID | 21205363 |
| Molecular Formula | C14H12ClIN2S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 3-(4-chlorophenyl)-5,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium iodide |
| SMILES | Cc1cc(C)[n+]2c(-c3ccc(Cl)cc3)csc2n1.[I-] |
| InChI | InChI=1S/C14H12ClN2S.HI/c1-9-7-10(2)17-13(8-18-14(17)16-9)11-3-5-12(15)6-4-11;/h3-8H,1-2H3;1H/q+1;/p-1 |
| InChIKey | QXLAUZMWQFRYQH-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|