C27H36N4O4 — CID 91223099
N-[[3-tert-butyl-5-[2-(3-ethoxy-7-imino-2,4-dimethyl-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methyl]propanamide (PubChem CID 91223099) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[[3-tert-butyl-5-[2-(3-ethoxy-7-imino-2,4-dimethyl-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methyl]propanamide.
| Compound Name | N-[[3-tert-butyl-5-[2-(3-ethoxy-7-imino-2,4-dimethyl-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methyl]propanamide |
|---|---|
| PubChem CID | 91223099 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[[3-tert-butyl-5-[2-(3-ethoxy-7-imino-2,4-dimethyl-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methyl]propanamide |
| SMILES | [H]/N=C1/c2nc(C)c(OCC)c(C)c2CN1CC(=O)c1cc(CNC(=O)CC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36N4O4/c1-8-22(33)29-12-18-10-17(11-20(24(18)34)27(5,6)7)21(32)14-31-13-19-15(3)25(35-9-2)16(4)30-23(19)26(31)28/h10-11,28,34H,8-9,12-14H2,1-7H3,(H,29,33)/b28-26- |
| InChIKey | UHZYEMYEJITXDC-SGEDCAFJSA-N |
| XLogP | 4.15 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|