C18H34N6O7 — CID 91226113
(2S)-2-amino-6-[[2-[(4-amino-4-carboxybutyl)amino]-5-(2,3,4-trihydroxybutyl)-1H-imidazol-4-yl]amino]hexanoic acid (PubChem CID 91226113) has the molecular formula C18H34N6O7 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-2-amino-6-[[2-[(4-amino-4-carboxybutyl)amino]-5-(2,3,4-trihydroxybutyl)-1H-imidazol-4-yl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[2-[(4-amino-4-carboxybutyl)amino]-5-(2,3,4-trihydroxybutyl)-1H-imidazol-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91226113 |
| Molecular Formula | C18H34N6O7 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2S)-2-amino-6-[[2-[(4-amino-4-carboxybutyl)amino]-5-(2,3,4-trihydroxybutyl)-1H-imidazol-4-yl]amino]hexanoic acid |
| SMILES | NC(CCCNc1nc(NCCCC[C@H](N)C(=O)O)c(CC(O)C(O)CO)[nH]1)C(=O)O |
| InChI | InChI=1S/C18H34N6O7/c19-10(16(28)29)4-1-2-6-21-15-12(8-13(26)14(27)9-25)23-18(24-15)22-7-3-5-11(20)17(30)31/h10-11,13-14,21,25-27H,1-9,19-20H2,(H,28,29)(H,30,31)(H2,22,23,24)/t10-,11?,13?,14?/m0/s1 |
| InChIKey | AZSWCKWYXJOJIK-LHDGGZGMSA-N |
| XLogP | -1.74 |
| TPSA | 240.07 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|