C12H22N4O6 — CID 91237557
(2S)-2-amino-5-[[4-hydroxy-5-(2,3,4-trihydroxybutyl)-1H-imidazol-2-yl]amino]pentanoic acid (PubChem CID 91237557) has the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (2S)-2-amino-5-[[4-hydroxy-5-(2,3,4-trihydroxybutyl)-1H-imidazol-2-yl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[4-hydroxy-5-(2,3,4-trihydroxybutyl)-1H-imidazol-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 91237557 |
| Molecular Formula | C12H22N4O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (2S)-2-amino-5-[[4-hydroxy-5-(2,3,4-trihydroxybutyl)-1H-imidazol-2-yl]amino]pentanoic acid |
| SMILES | N[C@@H](CCCNc1nc(O)c(CC(O)C(O)CO)[nH]1)C(=O)O |
| InChI | InChI=1S/C12H22N4O6/c13-6(11(21)22)2-1-3-14-12-15-7(10(20)16-12)4-8(18)9(19)5-17/h6,8-9,17-20H,1-5,13H2,(H,21,22)(H2,14,15,16)/t6-,8?,9?/m0/s1 |
| InChIKey | KRORZKDAIKZAGC-GVWIPJJGSA-N |
| XLogP | -2.02 |
| TPSA | 184.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|